C16H19N7O2S2 — CID 4988631
[[2-[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea (PubChem CID 4988631) has the molecular formula C16H19N7O2S2 and a molecular weight of 405.51 g/mol. Its IUPAC name is [[2-[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea.
| Compound Name | [[2-[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 4988631 |
| Molecular Formula | C16H19N7O2S2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [[2-[4-(3,5-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea |
| SMILES | Cc1cc(C)cc(-n2nnn(C3CC(=NNC(N)=S)C4OCC3O4)c2=S)c1 |
| InChI | InChI=1S/C16H19N7O2S2/c1-8-3-9(2)5-10(4-8)22-16(27)23(21-20-22)12-6-11(18-19-15(17)26)14-24-7-13(12)25-14/h3-5,12-14H,6-7H2,1-2H3,(H3,17,19,26) |
| InChIKey | FFLINNROFJNWBV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|