About 2-hydroxypropane-1,2,3-tricarboxylic acid;iron
2-hydroxypropane-1,2,3-tricarboxylic acid;iron (PubChem CID 4989393) has the molecular formula C6H8FeO7
and a molecular weight of 247.97 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;iron.
Molecular Properties
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;iron |
| PubChem CID | 4989393 |
| Molecular Formula | C6H8FeO7 |
| Molecular Weight | 247.97 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;iron |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[Fe] |
| InChI | InChI=1S/C6H8O7.Fe/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12); |
| InChIKey | HUTBITLDXCEAPZ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.97 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropane-1,2,3-tricarboxylic acid;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropane-1,2,3-tricarboxylic acid;iron?
The IUPAC name of 2-hydroxypropane-1,2,3-tricarboxylic acid;iron (CID 4989393) is 2-hydroxypropane-1,2,3-tricarboxylic acid;iron.
What is the SMILES notation for 2-hydroxypropane-1,2,3-tricarboxylic acid;iron?
The canonical SMILES for 2-hydroxypropane-1,2,3-tricarboxylic acid;iron is O=C(O)CC(O)(CC(=O)O)C(=O)O.[Fe].
What is the InChIKey of 2-hydroxypropane-1,2,3-tricarboxylic acid;iron?
The InChIKey is HUTBITLDXCEAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O7.Fe/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);.
What are the key properties of 2-hydroxypropane-1,2,3-tricarboxylic acid;iron?
2-hydroxypropane-1,2,3-tricarboxylic acid;iron has a molecular weight of 247.97 g/mol, XLogP of -1.25, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropane-1,2,3-tricarboxylic acid;iron is sourced from PubChem (CID 4989393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).