C13H8N4S — CID 4989900
2-thia-4,9,11,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,6,10,12,14,16-octaene (PubChem CID 4989900) has the molecular formula C13H8N4S and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-thia-4,9,11,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,6,10,12,14,16-octaene.
| Compound Name | 2-thia-4,9,11,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,6,10,12,14,16-octaene |
|---|---|
| PubChem CID | 4989900 |
| Molecular Formula | C13H8N4S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-thia-4,9,11,18-tetrazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,6,10,12,14,16-octaene |
| SMILES | c1cnc2c(c1)Nc1nc3ccccc3nc1S2 |
| InChI | InChI=1S/C13H8N4S/c1-2-5-9-8(4-1)15-11-13(17-9)18-12-10(16-11)6-3-7-14-12/h1-7H,(H,15,16) |
| InChIKey | ALZRULVLTQLGJE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |