About methyl 2-(dibenzylamino)acetate
methyl 2-(dibenzylamino)acetate (PubChem CID 4990071) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl 2-(dibenzylamino)acetate.
Molecular Properties
| Compound Name | methyl 2-(dibenzylamino)acetate |
| PubChem CID | 4990071 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 2-(dibenzylamino)acetate |
| SMILES | COC(=O)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-20-17(19)14-18(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11H,12-14H2,1H3 |
| InChIKey | LHIQQTZOSWEAKY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(dibenzylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(dibenzylamino)acetate?
The IUPAC name of methyl 2-(dibenzylamino)acetate (CID 4990071) is methyl 2-(dibenzylamino)acetate.
What is the SMILES notation for methyl 2-(dibenzylamino)acetate?
The canonical SMILES for methyl 2-(dibenzylamino)acetate is COC(=O)CN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of methyl 2-(dibenzylamino)acetate?
The InChIKey is LHIQQTZOSWEAKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-20-17(19)14-18(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11H,12-14H2,1H3.
What are the key properties of methyl 2-(dibenzylamino)acetate?
methyl 2-(dibenzylamino)acetate has a molecular weight of 269.34 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(dibenzylamino)acetate is sourced from PubChem (CID 4990071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).