C11H9N3O3S — CID 4990817
4,6-dioxo-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide (PubChem CID 4990817) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 4,6-dioxo-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide.
| Compound Name | 4,6-dioxo-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 4990817 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4,6-dioxo-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=S)NC(=O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H9N3O3S/c15-8(12-6-4-2-1-3-5-6)7-9(16)13-11(18)14-10(7)17/h1-5,7H,(H,12,15)(H2,13,14,16,17,18) |
| InChIKey | JARCFMKMOFFIGZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|