C17H22BrNO3 — CID 4990930
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-bromobenzoate (PubChem CID 4990930) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-bromobenzoate.
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 4990930 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 3-bromobenzoate |
| SMILES | CC1CCCC(NC(=O)COC(=O)c2cccc(Br)c2)C1C |
| InChI | InChI=1S/C17H22BrNO3/c1-11-5-3-8-15(12(11)2)19-16(20)10-22-17(21)13-6-4-7-14(18)9-13/h4,6-7,9,11-12,15H,3,5,8,10H2,1-2H3,(H,19,20) |
| InChIKey | QQEBKXADGXLDAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |