C21H37N2O3S+ — CID 4991237
2-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazin-1-ium-1-yl]ethanol (PubChem CID 4991237) has the molecular formula C21H37N2O3S+ and a molecular weight of 397.61 g/mol. Its IUPAC name is 2-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazin-1-ium-1-yl]ethanol.
| Compound Name | 2-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazin-1-ium-1-yl]ethanol |
|---|---|
| PubChem CID | 4991237 |
| Molecular Formula | C21H37N2O3S+ |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-[4-[2,4,6-tri(propan-2-yl)phenyl]sulfonylpiperazin-1-ium-1-yl]ethanol |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N2CC[NH+](CCO)CC2)c(C(C)C)c1 |
| InChI | InChI=1S/C21H36N2O3S/c1-15(2)18-13-19(16(3)4)21(20(14-18)17(5)6)27(25,26)23-9-7-22(8-10-23)11-12-24/h13-17,24H,7-12H2,1-6H3/p+1 |
| InChIKey | MYUCISFSIOGJSN-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |