About (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate
(2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate (PubChem CID 4992069) has the molecular formula C20H18N2O3S
and a molecular weight of 366.44 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate |
| PubChem CID | 4992069 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)OCc2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-14-7-9-15(10-8-14)19(24)21-11-18(23)25-12-17-13-26-20(22-17)16-5-3-2-4-6-16/h2-10,13H,11-12H2,1H3,(H,21,24) |
| InChIKey | LGHIMCHJGJWTOK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate (CID 4992069) is (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate is Cc1ccc(C(=O)NCC(=O)OCc2csc(-c3ccccc3)n2)cc1.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate?
The InChIKey is LGHIMCHJGJWTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O3S/c1-14-7-9-15(10-8-14)19(24)21-11-18(23)25-12-17-13-26-20(22-17)16-5-3-2-4-6-16/h2-10,13H,11-12H2,1H3,(H,21,24).
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate?
(2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate has a molecular weight of 366.44 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)methyl 2-[(4-methylbenzoyl)amino]acetate is sourced from PubChem (CID 4992069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).