C27H27N3O2 — CID 4992761
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol (PubChem CID 4992761) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol |
|---|---|
| PubChem CID | 4992761 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-hexoxyphenol |
| SMILES | CCCCCCOc1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C27H27N3O2/c1-2-3-4-11-18-32-22-16-17-23(24(31)19-22)27-29-25(20-12-7-5-8-13-20)28-26(30-27)21-14-9-6-10-15-21/h5-10,12-17,19,31H,2-4,11,18H2,1H3 |
| InChIKey | LEVFXWNQQSSNAC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|