C9H13NO2 — CID 4994
3,3-diethyl-1H-pyridine-2,4-dione (PubChem CID 4994) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 3,3-diethyl-1H-pyridine-2,4-dione.
| Compound Name | 3,3-diethyl-1H-pyridine-2,4-dione |
|---|---|
| PubChem CID | 4994 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 3,3-diethyl-1H-pyridine-2,4-dione |
| SMILES | CCC1(CC)C(=O)C=CNC1=O |
| InChI | InChI=1S/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | NZASCBIBXNPDMH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|