C32H34N4O2 — CID 4994656
1-N,4-N-bis[(4-phenylcyclohexylidene)amino]benzene-1,4-dicarboxamide (PubChem CID 4994656) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 1-N,4-N-bis[(4-phenylcyclohexylidene)amino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(4-phenylcyclohexylidene)amino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4994656 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 1-N,4-N-bis[(4-phenylcyclohexylidene)amino]benzene-1,4-dicarboxamide |
| SMILES | O=C(NN=C1CCC(c2ccccc2)CC1)c1ccc(C(=O)NN=C2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H34N4O2/c37-31(35-33-29-19-15-25(16-20-29)23-7-3-1-4-8-23)27-11-13-28(14-12-27)32(38)36-34-30-21-17-26(18-22-30)24-9-5-2-6-10-24/h1-14,25-26H,15-22H2,(H,35,37)(H,36,38)/b33-29-,34-30- |
| InChIKey | KOVAUFBOUAEZQE-YIVISXGPSA-N |
| XLogP | 6.57 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|