C10H19N3O2 — CID 4995630
N-tert-butyl-4-formylpiperazine-1-carboxamide (PubChem CID 4995630) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-tert-butyl-4-formylpiperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-formylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 4995630 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-tert-butyl-4-formylpiperazine-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C10H19N3O2/c1-10(2,3)11-9(15)13-6-4-12(8-14)5-7-13/h8H,4-7H2,1-3H3,(H,11,15) |
| InChIKey | WYNZGCSMHUNJJH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|