About 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene
6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene (PubChem CID 4996942) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene.
Molecular Properties
| Compound Name | 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene |
| PubChem CID | 4996942 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])CCCC2 |
| InChI | InChI=1S/C11H13NO3/c1-15-11-7-9-5-3-2-4-8(9)6-10(11)12(13)14/h6-7H,2-5H2,1H3 |
| InChIKey | LRDDQDMKDSLXCZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene?
The IUPAC name of 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene (CID 4996942) is 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene.
What is the SMILES notation for 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene?
The canonical SMILES for 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene is COc1cc2c(cc1[N+](=O)[O-])CCCC2.
What is the InChIKey of 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene?
The InChIKey is LRDDQDMKDSLXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-15-11-7-9-5-3-2-4-8(9)6-10(11)12(13)14/h6-7H,2-5H2,1H3.
What are the key properties of 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene?
6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene has a molecular weight of 207.23 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-7-nitro-1,2,3,4-tetrahydronaphthalene is sourced from PubChem (CID 4996942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).