About 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine
7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine (PubChem CID 4997367) has the molecular formula C15H12Cl3N
and a molecular weight of 312.63 g/mol. Its IUPAC name is 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine.
Molecular Properties
| Compound Name | 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine |
| PubChem CID | 4997367 |
| Molecular Formula | C15H12Cl3N |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine |
| SMILES | ClCN(CCl)c1ccc2c(c1)Cc1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C15H12Cl3N/c16-8-19(9-17)13-2-4-15-11(7-13)5-10-6-12(18)1-3-14(10)15/h1-4,6-7H,5,8-9H2 |
| InChIKey | PZJGCPANOGOPEL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine?
The IUPAC name of 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine (CID 4997367) is 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine.
What is the SMILES notation for 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine?
The canonical SMILES for 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine is ClCN(CCl)c1ccc2c(c1)Cc1cc(Cl)ccc1-2.
What is the InChIKey of 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine?
The InChIKey is PZJGCPANOGOPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl3N/c16-8-19(9-17)13-2-4-15-11(7-13)5-10-6-12(18)1-3-14(10)15/h1-4,6-7H,5,8-9H2.
What are the key properties of 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine?
7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine has a molecular weight of 312.63 g/mol, XLogP of 5.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N,N-bis(chloromethyl)-9H-fluoren-2-amine is sourced from PubChem (CID 4997367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).