C22H20ClFN2O5S — CID 4998437
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-chloro-3-[(4-fluorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 4998437) has the molecular formula C22H20ClFN2O5S and a molecular weight of 478.93 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-chloro-3-[(4-fluorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-chloro-3-[(4-fluorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 4998437 |
| Molecular Formula | C22H20ClFN2O5S |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-chloro-3-[(4-fluorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(F)cc1)S(=O)(=O)c1cc(C(=O)OCc2c(C)noc2C)ccc1Cl |
| InChI | InChI=1S/C22H20ClFN2O5S/c1-4-11-26(18-8-6-17(24)7-9-18)32(28,29)21-12-16(5-10-20(21)23)22(27)30-13-19-14(2)25-31-15(19)3/h4-10,12H,1,11,13H2,2-3H3 |
| InChIKey | CULPUMWIQOVYPZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|