C25H26BrCl2N7O3 — CID 4998675
3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]adamantane-1-carboxamide (PubChem CID 4998675) has the molecular formula C25H26BrCl2N7O3 and a molecular weight of 623.34 g/mol. Its IUPAC name is 3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]adamantane-1-carboxamide.
| Compound Name | 3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4998675 |
| Molecular Formula | C25H26BrCl2N7O3 |
| Molecular Weight | 623.34 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | 3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]adamantane-1-carboxamide |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2Cl)c(C)c1NC(=O)C12CC3CC(C1)CC(n1nc([N+](=O)[O-])nc1Br)(C3)C2 |
| InChI | InChI=1S/C25H26BrCl2N7O3/c1-13-20(14(2)33(31-13)11-17-3-4-18(27)6-19(17)28)29-21(36)24-7-15-5-16(8-24)10-25(9-15,12-24)34-22(26)30-23(32-34)35(37)38/h3-4,6,15-16H,5,7-12H2,1-2H3,(H,29,36) |
| InChIKey | TXTKSYWEIBDFEN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|