C17H11ClF4N2S — CID 4999
View drug profile → quazepam7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepine-2-thione (PubChem CID 4999) has the molecular formula C17H11ClF4N2S and a molecular weight of 386.80 g/mol. Its IUPAC name is 7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepine-2-thione.
| Compound Name | 7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 4999 |
| Molecular Formula | C17H11ClF4N2S |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 7-chloro-5-(2-fluorophenyl)-1-(2,2,2-trifluoroethyl)-3H-1,4-benzodiazepine-2-thione |
| SMILES | Fc1ccccc1C1=NCC(=S)N(CC(F)(F)F)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H11ClF4N2S/c18-10-5-6-14-12(7-10)16(11-3-1-2-4-13(11)19)23-8-15(25)24(14)9-17(20,21)22/h1-7H,8-9H2 |
| InChIKey | IKMPWMZBZSAONZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|