About 2-(tritylamino)propanoic acid
2-(tritylamino)propanoic acid (PubChem CID 4999077) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(tritylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-(tritylamino)propanoic acid |
| PubChem CID | 4999077 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-(tritylamino)propanoic acid |
| SMILES | CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H21NO2/c1-17(21(24)25)23-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,23H,1H3,(H,24,25) |
| InChIKey | DWQQRTJQHUWCPX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-(tritylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tritylamino)propanoic acid?
The IUPAC name of 2-(tritylamino)propanoic acid (CID 4999077) is 2-(tritylamino)propanoic acid.
What is the SMILES notation for 2-(tritylamino)propanoic acid?
The canonical SMILES for 2-(tritylamino)propanoic acid is CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O.
What is the InChIKey of 2-(tritylamino)propanoic acid?
The InChIKey is DWQQRTJQHUWCPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c1-17(21(24)25)23-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17,23H,1H3,(H,24,25).
What are the key properties of 2-(tritylamino)propanoic acid?
2-(tritylamino)propanoic acid has a molecular weight of 331.42 g/mol, XLogP of 4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tritylamino)propanoic acid is sourced from PubChem (CID 4999077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).