About 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine
4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine (PubChem CID 4999242) has the molecular formula C13H15Cl2N3
and a molecular weight of 284.19 g/mol. Its IUPAC name is 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine.
Molecular Properties
| Compound Name | 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine |
| PubChem CID | 4999242 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine |
| SMILES | Cc1cc(C(C)(C)C)n(-c2c(Cl)cncc2Cl)n1 |
| InChI | InChI=1S/C13H15Cl2N3/c1-8-5-11(13(2,3)4)18(17-8)12-9(14)6-16-7-10(12)15/h5-7H,1-4H3 |
| InChIKey | XOUCMZFGJSFIEJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine?
The IUPAC name of 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine (CID 4999242) is 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine.
What is the SMILES notation for 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine?
The canonical SMILES for 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine is Cc1cc(C(C)(C)C)n(-c2c(Cl)cncc2Cl)n1.
What is the InChIKey of 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine?
The InChIKey is XOUCMZFGJSFIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2N3/c1-8-5-11(13(2,3)4)18(17-8)12-9(14)6-16-7-10(12)15/h5-7H,1-4H3.
What are the key properties of 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine?
4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine has a molecular weight of 284.19 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-tert-butyl-3-methylpyrazol-1-yl)-3,5-dichloropyridine is sourced from PubChem (CID 4999242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).