C18H20N2O4 — CID 4999432
methyl 3-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate (PubChem CID 4999432) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl 3-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate.
| Compound Name | methyl 3-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 4999432 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 3-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)NCCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-23-16-8-3-5-13(11-16)9-10-19-18(22)20-15-7-4-6-14(12-15)17(21)24-2/h3-8,11-12H,9-10H2,1-2H3,(H2,19,20,22) |
| InChIKey | ONTHBRVQBZFMJR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |