About 5-ethyl-2-iodophenol
5-ethyl-2-iodophenol (PubChem CID 22996199) has the molecular formula C8H9IO
and a molecular weight of 248.06 g/mol. Its IUPAC name is 5-ethyl-2-iodophenol.
Molecular Properties
| Compound Name | 5-ethyl-2-iodophenol |
| PubChem CID | 22996199 |
| Molecular Formula | C8H9IO |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 5-ethyl-2-iodophenol |
| SMILES | CCc1ccc(I)c(O)c1 |
| InChI | InChI=1S/C8H9IO/c1-2-6-3-4-7(9)8(10)5-6/h3-5,10H,2H2,1H3 |
| InChIKey | YZGKKAKCVYCTGL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-iodophenol?
The IUPAC name of 5-ethyl-2-iodophenol (CID 22996199) is 5-ethyl-2-iodophenol.
What is the SMILES notation for 5-ethyl-2-iodophenol?
The canonical SMILES for 5-ethyl-2-iodophenol is CCc1ccc(I)c(O)c1.
What is the InChIKey of 5-ethyl-2-iodophenol?
The InChIKey is YZGKKAKCVYCTGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IO/c1-2-6-3-4-7(9)8(10)5-6/h3-5,10H,2H2,1H3.
What are the key properties of 5-ethyl-2-iodophenol?
5-ethyl-2-iodophenol has a molecular weight of 248.06 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-iodophenol is sourced from PubChem (CID 22996199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).