About 5-hydroxypentylurea
5-hydroxypentylurea (PubChem CID 22179523) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-hydroxypentylurea.
Molecular Properties
| Compound Name | 5-hydroxypentylurea |
| PubChem CID | 22179523 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 5-hydroxypentylurea |
| SMILES | NC(=O)NCCCCCO |
| InChI | InChI=1S/C6H14N2O2/c7-6(10)8-4-2-1-3-5-9/h9H,1-5H2,(H3,7,8,10) |
| InChIKey | YENLKAMLRHCUCQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxypentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxypentylurea?
The IUPAC name of 5-hydroxypentylurea (CID 22179523) is 5-hydroxypentylurea.
What is the SMILES notation for 5-hydroxypentylurea?
The canonical SMILES for 5-hydroxypentylurea is NC(=O)NCCCCCO.
What is the InChIKey of 5-hydroxypentylurea?
The InChIKey is YENLKAMLRHCUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c7-6(10)8-4-2-1-3-5-9/h9H,1-5H2,(H3,7,8,10).
What are the key properties of 5-hydroxypentylurea?
5-hydroxypentylurea has a molecular weight of 146.19 g/mol, XLogP of -0.18, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxypentylurea is sourced from PubChem (CID 22179523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).