About bis(1-hydroxypyridine-2-thione);zinc
bis(1-hydroxypyridine-2-thione);zinc (PubChem CID 500025) has the molecular formula C10H10N2O2S2Zn
and a molecular weight of 319.73 g/mol. Its IUPAC name is bis(1-hydroxypyridine-2-thione);zinc.
Molecular Properties
| Compound Name | bis(1-hydroxypyridine-2-thione);zinc |
| PubChem CID | 500025 |
| Molecular Formula | C10H10N2O2S2Zn |
| Molecular Weight | 319.73 g/mol |
| Exact Mass | 317.95 |
| IUPAC Name | bis(1-hydroxypyridine-2-thione);zinc |
| SMILES | On1ccccc1=S.On1ccccc1=S.[Zn] |
| InChI | InChI=1S/2C5H5NOS.Zn/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,7H; |
| InChIKey | JVAIRLPQTSEMRF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(1-hydroxypyridine-2-thione);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-hydroxypyridine-2-thione);zinc?
The IUPAC name of bis(1-hydroxypyridine-2-thione);zinc (CID 500025) is bis(1-hydroxypyridine-2-thione);zinc.
What is the SMILES notation for bis(1-hydroxypyridine-2-thione);zinc?
The canonical SMILES for bis(1-hydroxypyridine-2-thione);zinc is On1ccccc1=S.On1ccccc1=S.[Zn].
What is the InChIKey of bis(1-hydroxypyridine-2-thione);zinc?
The InChIKey is JVAIRLPQTSEMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5NOS.Zn/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,7H;.
What are the key properties of bis(1-hydroxypyridine-2-thione);zinc?
bis(1-hydroxypyridine-2-thione);zinc has a molecular weight of 319.73 g/mol, XLogP of 2.91, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-hydroxypyridine-2-thione);zinc is sourced from PubChem (CID 500025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).