C10H10Cl3NO2 — CID 5000265
4,4,4-trichloro-3-hydroxy-N-phenylbutanamide (PubChem CID 5000265) has the molecular formula C10H10Cl3NO2 and a molecular weight of 282.55 g/mol. Its IUPAC name is 4,4,4-trichloro-3-hydroxy-N-phenylbutanamide.
| Compound Name | 4,4,4-trichloro-3-hydroxy-N-phenylbutanamide |
|---|---|
| PubChem CID | 5000265 |
| Molecular Formula | C10H10Cl3NO2 |
| Molecular Weight | 282.55 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 4,4,4-trichloro-3-hydroxy-N-phenylbutanamide |
| SMILES | O=C(CC(O)C(Cl)(Cl)Cl)Nc1ccccc1 |
| InChI | InChI=1S/C10H10Cl3NO2/c11-10(12,13)8(15)6-9(16)14-7-4-2-1-3-5-7/h1-5,8,15H,6H2,(H,14,16) |
| InChIKey | APOFPCLVKWHVJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|