About 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea
3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea (PubChem CID 5000980) has the molecular formula C13H15ClN2O
and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea |
| PubChem CID | 5000980 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClN2O/c1-3-9-16(10-4-2)13(17)15-12-7-5-11(14)6-8-12/h3-8H,1-2,9-10H2,(H,15,17) |
| InChIKey | VYCAHPBJVVVEBW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea?
The IUPAC name of 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea (CID 5000980) is 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea.
What is the SMILES notation for 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea?
The canonical SMILES for 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea is C=CCN(CC=C)C(=O)Nc1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea?
The InChIKey is VYCAHPBJVVVEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O/c1-3-9-16(10-4-2)13(17)15-12-7-5-11(14)6-8-12/h3-8H,1-2,9-10H2,(H,15,17).
What are the key properties of 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea?
3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea has a molecular weight of 250.73 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1,1-bis(prop-2-enyl)urea is sourced from PubChem (CID 5000980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).