C16H7F5O — CID 5001252
2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3H-inden-1-one (PubChem CID 5001252) has the molecular formula C16H7F5O and a molecular weight of 310.22 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3H-inden-1-one.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3H-inden-1-one |
|---|---|
| PubChem CID | 5001252 |
| Molecular Formula | C16H7F5O |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)methylidene]-3H-inden-1-one |
| SMILES | O=C1C(=Cc2c(F)c(F)c(F)c(F)c2F)Cc2ccccc21 |
| InChI | InChI=1S/C16H7F5O/c17-11-10(12(18)14(20)15(21)13(11)19)6-8-5-7-3-1-2-4-9(7)16(8)22/h1-4,6H,5H2 |
| InChIKey | ONWWLRMPGIEKAM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|