About ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate
ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate (PubChem CID 5001969) has the molecular formula C24H20BrN3O3
and a molecular weight of 478.35 g/mol. Its IUPAC name is ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate |
| PubChem CID | 5001969 |
| Molecular Formula | C24H20BrN3O3 |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cn2c3ccc(Br)cc3c3nc4cc(C)c(C)cc4nc32)o1 |
| InChI | InChI=1S/C24H20BrN3O3/c1-4-30-24(29)21-8-6-16(31-21)12-28-20-7-5-15(25)11-17(20)22-23(28)27-19-10-14(3)13(2)9-18(19)26-22/h5-11H,4,12H2,1-3H3 |
| InChIKey | QOCSALPCOOSXBX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate (CID 5001969) is ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate is CCOC(=O)c1ccc(Cn2c3ccc(Br)cc3c3nc4cc(C)c(C)cc4nc32)o1.
What is the InChIKey of ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate?
The InChIKey is QOCSALPCOOSXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20BrN3O3/c1-4-30-24(29)21-8-6-16(31-21)12-28-20-7-5-15(25)11-17(20)22-23(28)27-19-10-14(3)13(2)9-18(19)26-22/h5-11H,4,12H2,1-3H3.
What are the key properties of ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate?
ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate has a molecular weight of 478.35 g/mol, XLogP of 5.94, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(9-bromo-2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)methyl]furan-2-carboxylate is sourced from PubChem (CID 5001969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).