About 3-chloro-N,N-bis(prop-2-ynyl)aniline
3-chloro-N,N-bis(prop-2-ynyl)aniline (PubChem CID 5001996) has the molecular formula C12H10ClN
and a molecular weight of 203.67 g/mol. Its IUPAC name is 3-chloro-N,N-bis(prop-2-ynyl)aniline.
Molecular Properties
| Compound Name | 3-chloro-N,N-bis(prop-2-ynyl)aniline |
| PubChem CID | 5001996 |
| Molecular Formula | C12H10ClN |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-chloro-N,N-bis(prop-2-ynyl)aniline |
| SMILES | C#CCN(CC#C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H10ClN/c1-3-8-14(9-4-2)12-7-5-6-11(13)10-12/h1-2,5-7,10H,8-9H2 |
| InChIKey | RJSSZPOGIKHODP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N,N-bis(prop-2-ynyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,N-bis(prop-2-ynyl)aniline?
The IUPAC name of 3-chloro-N,N-bis(prop-2-ynyl)aniline (CID 5001996) is 3-chloro-N,N-bis(prop-2-ynyl)aniline.
What is the SMILES notation for 3-chloro-N,N-bis(prop-2-ynyl)aniline?
The canonical SMILES for 3-chloro-N,N-bis(prop-2-ynyl)aniline is C#CCN(CC#C)c1cccc(Cl)c1.
What is the InChIKey of 3-chloro-N,N-bis(prop-2-ynyl)aniline?
The InChIKey is RJSSZPOGIKHODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN/c1-3-8-14(9-4-2)12-7-5-6-11(13)10-12/h1-2,5-7,10H,8-9H2.
What are the key properties of 3-chloro-N,N-bis(prop-2-ynyl)aniline?
3-chloro-N,N-bis(prop-2-ynyl)aniline has a molecular weight of 203.67 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,N-bis(prop-2-ynyl)aniline is sourced from PubChem (CID 5001996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).