About CID 500314
CID 500314 (PubChem CID 500314) has the molecular formula C20H22ClNO
and a molecular weight of 327.86 g/mol.
Molecular Properties
| Compound Name | CID 500314 |
| PubChem CID | 500314 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | — |
| SMILES | OC([CH][CH]CN1CCCC1)(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClNO/c21-19-11-9-18(10-12-19)20(23,17-7-2-1-3-8-17)13-6-16-22-14-4-5-15-22/h1-3,6-13,23H,4-5,14-16H2 |
| InChIKey | LMHBZTMEVJLJDC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 500314 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 500314?
The IUPAC name of CID 500314 (CID 500314) is not available.
What is the SMILES notation for CID 500314?
The canonical SMILES for CID 500314 is OC([CH][CH]CN1CCCC1)(c1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of CID 500314?
The InChIKey is LMHBZTMEVJLJDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClNO/c21-19-11-9-18(10-12-19)20(23,17-7-2-1-3-8-17)13-6-16-22-14-4-5-15-22/h1-3,6-13,23H,4-5,14-16H2.
What are the key properties of CID 500314?
CID 500314 has a molecular weight of 327.86 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 500314 is sourced from PubChem (CID 500314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).