C35H40O11 — CID 500394
[6,8,8-trimethyl-2-oxo-9-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxy-9,10-dihydropyrano[2,3-f]chromen-10-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 500394) has the molecular formula C35H40O11 and a molecular weight of 636.69 g/mol. Its IUPAC name is [6,8,8-trimethyl-2-oxo-9-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxy-9,10-dihydropyrano[2,3-f]chromen-10-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [6,8,8-trimethyl-2-oxo-9-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxy-9,10-dihydropyrano[2,3-f]chromen-10-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 500394 |
| Molecular Formula | C35H40O11 |
| Molecular Weight | 636.69 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | [6,8,8-trimethyl-2-oxo-9-(4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl)oxy-9,10-dihydropyrano[2,3-f]chromen-10-yl] 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | Cc1cc2ccc(=O)oc2c2c1OC(C)(C)C(OC(=O)C13CCC(C)(C(=O)O1)C3(C)C)C2OC(=O)C12CCC(C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C35H40O11/c1-17-16-18-10-11-19(36)41-22(18)20-21(17)44-29(2,3)24(43-28(40)35-15-13-33(9,26(38)46-35)31(35,6)7)23(20)42-27(39)34-14-12-32(8,25(37)45-34)30(34,4)5/h10-11,16,23-24H,12-15H2,1-9H3 |
| InChIKey | GXSSXFWLNIQEHQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 144.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|