C20H33N3O2S — CID 5005035
N-[2-(cyclohexen-1-yl)ethyl]-4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide (PubChem CID 5005035) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 5005035 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(2-oxo-4-propan-2-yl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide |
| SMILES | CC(C)C1COC(=O)N1C1CCN(C(=S)NCCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C20H33N3O2S/c1-15(2)18-14-25-20(24)23(18)17-9-12-22(13-10-17)19(26)21-11-8-16-6-4-3-5-7-16/h6,15,17-18H,3-5,7-14H2,1-2H3,(H,21,26) |
| InChIKey | DZMCMYDIOFPHHX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|