C27H46ClNO2 — CID 5005189
7-chloro-10,13-dimethyl-17-(6-methylheptan-2-yl)-7-nitro-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 5005189) has the molecular formula C27H46ClNO2 and a molecular weight of 452.12 g/mol. Its IUPAC name is 7-chloro-10,13-dimethyl-17-(6-methylheptan-2-yl)-7-nitro-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | 7-chloro-10,13-dimethyl-17-(6-methylheptan-2-yl)-7-nitro-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 5005189 |
| Molecular Formula | C27H46ClNO2 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | 7-chloro-10,13-dimethyl-17-(6-methylheptan-2-yl)-7-nitro-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCCCC1CC3(Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C27H46ClNO2/c1-18(2)9-8-10-19(3)21-12-13-22-24-23(14-16-26(21,22)5)25(4)15-7-6-11-20(25)17-27(24,28)29(30)31/h18-24H,6-17H2,1-5H3 |
| InChIKey | WLCMLNQXGZCMEO-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|