About 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one
9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (PubChem CID 5005498) has the molecular formula C16H11N3O3
and a molecular weight of 293.28 g/mol. Its IUPAC name is 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
Molecular Properties
| Compound Name | 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| PubChem CID | 5005498 |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2c([nH]c3ccc([N+](=O)[O-])cc23)-c2ccccc2N1 |
| InChI | InChI=1S/C16H11N3O3/c20-15-8-12-11-7-9(19(21)22)5-6-14(11)18-16(12)10-3-1-2-4-13(10)17-15/h1-7,18H,8H2,(H,17,20) |
| InChIKey | OLUKILHGKRVDCT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
The IUPAC name of 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (CID 5005498) is 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
What is the SMILES notation for 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
The canonical SMILES for 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one is O=C1Cc2c([nH]c3ccc([N+](=O)[O-])cc23)-c2ccccc2N1.
What is the InChIKey of 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
The InChIKey is OLUKILHGKRVDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O3/c20-15-8-12-11-7-9(19(21)22)5-6-14(11)18-16(12)10-3-1-2-4-13(10)17-15/h1-7,18H,8H2,(H,17,20).
What are the key properties of 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one?
9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one has a molecular weight of 293.28 g/mol, XLogP of 3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one is sourced from PubChem (CID 5005498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).