About (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium
(3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium (PubChem CID 5005876) has the molecular formula C17H20NO3+
and a molecular weight of 286.35 g/mol. Its IUPAC name is (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium.
Molecular Properties
| Compound Name | (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium |
| PubChem CID | 5005876 |
| Molecular Formula | C17H20NO3+ |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium |
| SMILES | C[NH+](C)CC1Oc2ccccc2OC1(O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-18(2)12-16-17(19,13-8-4-3-5-9-13)21-15-11-7-6-10-14(15)20-16/h3-11,16,19H,12H2,1-2H3/p+1 |
| InChIKey | QTMIOKJVXMNHMR-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium?
The IUPAC name of (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium (CID 5005876) is (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium.
What is the SMILES notation for (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium?
The canonical SMILES for (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium is C[NH+](C)CC1Oc2ccccc2OC1(O)c1ccccc1.
What is the InChIKey of (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium?
The InChIKey is QTMIOKJVXMNHMR-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H19NO3/c1-18(2)12-16-17(19,13-8-4-3-5-9-13)21-15-11-7-6-10-14(15)20-16/h3-11,16,19H,12H2,1-2H3/p+1.
What are the key properties of (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium?
(3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium has a molecular weight of 286.35 g/mol, XLogP of 0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-3-phenyl-2H-1,4-benzodioxin-2-yl)methyl-dimethylazanium is sourced from PubChem (CID 5005876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).