About 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene
1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene (PubChem CID 5006204) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene.
Molecular Properties
| Compound Name | 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene |
| PubChem CID | 5006204 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene |
| SMILES | C=CCC(C=C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16O2S/c1-4-6-12(5-2)16(14,15)13-9-7-11(3)8-10-13/h4-5,7-10,12H,1-2,6H2,3H3 |
| InChIKey | RVILKSXCLSXCRJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene?
The IUPAC name of 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene (CID 5006204) is 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene.
What is the SMILES notation for 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene?
The canonical SMILES for 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene is C=CCC(C=C)S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene?
The InChIKey is RVILKSXCLSXCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c1-4-6-12(5-2)16(14,15)13-9-7-11(3)8-10-13/h4-5,7-10,12H,1-2,6H2,3H3.
What are the key properties of 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene?
1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene has a molecular weight of 236.34 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexa-1,5-dien-3-ylsulfonyl-4-methylbenzene is sourced from PubChem (CID 5006204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).