C19H22O3S — CID 5006205
6-(4-methylphenyl)sulfonyl-1-phenylhexan-1-one (PubChem CID 5006205) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyl-1-phenylhexan-1-one.
| Compound Name | 6-(4-methylphenyl)sulfonyl-1-phenylhexan-1-one |
|---|---|
| PubChem CID | 5006205 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyl-1-phenylhexan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)CCCCCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O3S/c1-16-11-13-18(14-12-16)23(21,22)15-7-3-6-10-19(20)17-8-4-2-5-9-17/h2,4-5,8-9,11-14H,3,6-7,10,15H2,1H3 |
| InChIKey | YEUUNRBSAIFVIW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|