About N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine
N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 5007494) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 5007494 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccco1 |
| InChI | InChI=1S/C9H16N2O/c1-11(2)6-5-10-8-9-4-3-7-12-9/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | FSUKHKIOJCSGHL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine (CID 5007494) is N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine is CN(C)CCNCc1ccco1.
What is the InChIKey of N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is FSUKHKIOJCSGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-11(2)6-5-10-8-9-4-3-7-12-9/h3-4,7,10H,5-6,8H2,1-2H3.
What are the key properties of N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine?
N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 168.24 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 5007494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).