About 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one
2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one (PubChem CID 5008066) has the molecular formula C12H23NO2S
and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one |
| PubChem CID | 5008066 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one |
| SMILES | CCCCC1SCC(=O)N1CC(C)(C)CO |
| InChI | InChI=1S/C12H23NO2S/c1-4-5-6-11-13(10(15)7-16-11)8-12(2,3)9-14/h11,14H,4-9H2,1-3H3 |
| InChIKey | VOLYQLZTUKTXOC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one (CID 5008066) is 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one is CCCCC1SCC(=O)N1CC(C)(C)CO.
What is the InChIKey of 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one?
The InChIKey is VOLYQLZTUKTXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2S/c1-4-5-6-11-13(10(15)7-16-11)8-12(2,3)9-14/h11,14H,4-9H2,1-3H3.
What are the key properties of 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one?
2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one has a molecular weight of 245.39 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3-(3-hydroxy-2,2-dimethylpropyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 5008066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).