About 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole
4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole (PubChem CID 5008282) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole |
| PubChem CID | 5008282 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cccs2)=N1 |
| InChI | InChI=1S/C9H11NOS/c1-9(2)6-11-8(10-9)7-4-3-5-12-7/h3-5H,6H2,1-2H3 |
| InChIKey | KLKPHMUQDGHCPL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole?
The IUPAC name of 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole (CID 5008282) is 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole.
What is the SMILES notation for 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole?
The canonical SMILES for 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole is CC1(C)COC(c2cccs2)=N1.
What is the InChIKey of 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole?
The InChIKey is KLKPHMUQDGHCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c1-9(2)6-11-8(10-9)7-4-3-5-12-7/h3-5H,6H2,1-2H3.
What are the key properties of 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole?
4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole has a molecular weight of 181.26 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-thiophen-2-yl-5H-1,3-oxazole is sourced from PubChem (CID 5008282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).