C13H14F11NO — CID 5008429
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipropylcyclohexane-1-carboxamide (PubChem CID 5008429) has the molecular formula C13H14F11NO and a molecular weight of 409.24 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipropylcyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipropylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5008429 |
| Molecular Formula | C13H14F11NO |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N,N-dipropylcyclohexane-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H14F11NO/c1-3-5-25(6-4-2)7(26)8(14)9(15,16)11(19,20)13(23,24)12(21,22)10(8,17)18/h3-6H2,1-2H3 |
| InChIKey | UBNLVNUKVPSNDH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|