C25H23N5O4S — CID 5008558
2-[2-oxo-3-[6-oxo-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]indol-1-yl]acetamide (PubChem CID 5008558) has the molecular formula C25H23N5O4S and a molecular weight of 489.56 g/mol. Its IUPAC name is 2-[2-oxo-3-[6-oxo-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]indol-1-yl]acetamide.
| Compound Name | 2-[2-oxo-3-[6-oxo-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 5008558 |
| Molecular Formula | C25H23N5O4S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[2-oxo-3-[6-oxo-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]indol-1-yl]acetamide |
| SMILES | CCCCCOc1ccc(-c2nc3sc(=C4C(=O)N(CC(N)=O)c5ccccc54)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C25H23N5O4S/c1-2-3-6-13-34-16-11-9-15(10-12-16)22-27-25-30(28-22)24(33)21(35-25)20-17-7-4-5-8-18(17)29(23(20)32)14-19(26)31/h4-5,7-12H,2-3,6,13-14H2,1H3,(H2,26,31) |
| InChIKey | CELDIJSLTFGFSF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|