C18H26O4 — CID 500885
methyl (1S,4aR,5S,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate (PubChem CID 500885) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 500885 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-5-(2-methoxy-2-oxoethyl)-1,4a-dimethyl-6-methylidene-3,4,5,8a-tetrahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1C=C[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C18H26O4/c1-12-7-8-14-17(2,13(12)11-15(19)21-4)9-6-10-18(14,3)16(20)22-5/h7-8,13-14H,1,6,9-11H2,2-5H3/t13-,14+,17+,18-/m0/s1 |
| InChIKey | AJUGDJQAYHMVHJ-JFTQMJAMSA-N |
| XLogP | 3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |