C17H20O4 — CID 500895
methyl (6aR,7S,10aS)-7,10a-dimethyl-2-oxo-6a,8,9,10-tetrahydrobenzo[f]isochromene-7-carboxylate (PubChem CID 500895) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl (6aR,7S,10aS)-7,10a-dimethyl-2-oxo-6a,8,9,10-tetrahydrobenzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (6aR,7S,10aS)-7,10a-dimethyl-2-oxo-6a,8,9,10-tetrahydrobenzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 500895 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methyl (6aR,7S,10aS)-7,10a-dimethyl-2-oxo-6a,8,9,10-tetrahydrobenzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc(=O)occ3C=C[C@@H]12 |
| InChI | InChI=1S/C17H20O4/c1-16-7-4-8-17(2,15(19)20-3)13(16)6-5-11-10-21-14(18)9-12(11)16/h5-6,9-10,13H,4,7-8H2,1-3H3/t13-,16-,17+/m1/s1 |
| InChIKey | NNDGDSUOMACMCZ-XYPHTWIQSA-N |
| XLogP | 2.90 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |