C19H19F3N2O3 — CID 5009862
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate (PubChem CID 5009862) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
|---|---|
| PubChem CID | 5009862 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
| SMILES | O=C(COC(=O)c1c2c(nc3ccccc13)CCCCC2)NCC(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)11-23-16(25)10-27-18(26)17-12-6-2-1-3-8-14(12)24-15-9-5-4-7-13(15)17/h4-5,7,9H,1-3,6,8,10-11H2,(H,23,25) |
| InChIKey | MRBYKTNDAIOOBD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |