C26H26N2O6 — CID 5010931
1-(1-benzofuran-2-yl)-5-butyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5010931) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-5-butyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(1-benzofuran-2-yl)-5-butyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5010931 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-5-butyl-3-[(4-hydroxyphenyl)methyl]-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCCCN1C(=O)C2C(c3cc4ccccc4o3)NC(Cc3ccc(O)cc3)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C26H26N2O6/c1-2-3-12-28-23(30)20-21(24(28)31)26(25(32)33,14-15-8-10-17(29)11-9-15)27-22(20)19-13-16-6-4-5-7-18(16)34-19/h4-11,13,20-22,27,29H,2-3,12,14H2,1H3,(H,32,33) |
| InChIKey | FHNRBUZYEOPRSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|