C28H33N3O2S — CID 5010950
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-N-(oxolan-2-ylmethyl)-5-(2-phenyl-1,3-thiazol-4-yl)pyrrole-3-carboxamide (PubChem CID 5010950) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-N-(oxolan-2-ylmethyl)-5-(2-phenyl-1,3-thiazol-4-yl)pyrrole-3-carboxamide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-N-(oxolan-2-ylmethyl)-5-(2-phenyl-1,3-thiazol-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 5010950 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-N-(oxolan-2-ylmethyl)-5-(2-phenyl-1,3-thiazol-4-yl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCC2CCCO2)cc(-c2csc(-c3ccccc3)n2)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C28H33N3O2S/c1-20-24(27(32)29-18-23-13-8-16-33-23)17-26(31(20)15-14-21-9-4-2-5-10-21)25-19-34-28(30-25)22-11-6-3-7-12-22/h3,6-7,9,11-12,17,19,23H,2,4-5,8,10,13-16,18H2,1H3,(H,29,32) |
| InChIKey | SVHBHTXDDUWWMK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|