C26H23ClFN3O2S — CID 5011074
2-[1-(4-chlorophenyl)-5-oxo-3-(3-phenylpropyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 5011074) has the molecular formula C26H23ClFN3O2S and a molecular weight of 496.01 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-5-oxo-3-(3-phenylpropyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)-5-oxo-3-(3-phenylpropyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 5011074 |
| Molecular Formula | C26H23ClFN3O2S |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-5-oxo-3-(3-phenylpropyl)-2-sulfanylideneimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CC1C(=O)N(c2ccc(Cl)cc2)C(=S)N1CCCc1ccccc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H23ClFN3O2S/c27-19-8-14-22(15-9-19)31-25(33)23(17-24(32)29-21-12-10-20(28)11-13-21)30(26(31)34)16-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-15,23H,4,7,16-17H2,(H,29,32) |
| InChIKey | MBAHOGUQRLCUMB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|