C8H8F2O — CID 5012075
1-(2,6-difluorophenyl)ethanol (PubChem CID 5012075) has the molecular formula C8H8F2O and a molecular weight of 158.15 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)ethanol.
| Compound Name | 1-(2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 5012075 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 1-(2,6-difluorophenyl)ethanol |
| SMILES | CC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C8H8F2O/c1-5(11)8-6(9)3-2-4-7(8)10/h2-5,11H,1H3 |
| InChIKey | SIYWDKQSSDBLOA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |