About 2-benzylsulfonylpyridine
2-benzylsulfonylpyridine (PubChem CID 501231) has the molecular formula C12H11NO2S
and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-benzylsulfonylpyridine.
Molecular Properties
| Compound Name | 2-benzylsulfonylpyridine |
| PubChem CID | 501231 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-benzylsulfonylpyridine |
| SMILES | O=S(=O)(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C12H11NO2S/c14-16(15,12-8-4-5-9-13-12)10-11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | DHGLVTBPYFPTFX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfonylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfonylpyridine?
The IUPAC name of 2-benzylsulfonylpyridine (CID 501231) is 2-benzylsulfonylpyridine.
What is the SMILES notation for 2-benzylsulfonylpyridine?
The canonical SMILES for 2-benzylsulfonylpyridine is O=S(=O)(Cc1ccccc1)c1ccccn1.
What is the InChIKey of 2-benzylsulfonylpyridine?
The InChIKey is DHGLVTBPYFPTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S/c14-16(15,12-8-4-5-9-13-12)10-11-6-2-1-3-7-11/h1-9H,10H2.
What are the key properties of 2-benzylsulfonylpyridine?
2-benzylsulfonylpyridine has a molecular weight of 233.29 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfonylpyridine is sourced from PubChem (CID 501231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).