About (4-nitrophenyl)methyl pyridine-2-carboxylate
(4-nitrophenyl)methyl pyridine-2-carboxylate (PubChem CID 501281) has the molecular formula C13H10N2O4
and a molecular weight of 258.23 g/mol. Its IUPAC name is (4-nitrophenyl)methyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl pyridine-2-carboxylate |
| PubChem CID | 501281 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (4-nitrophenyl)methyl pyridine-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)c1ccccn1 |
| InChI | InChI=1S/C13H10N2O4/c16-13(12-3-1-2-8-14-12)19-9-10-4-6-11(7-5-10)15(17)18/h1-8H,9H2 |
| InChIKey | VZLAOZFWLRTVNX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl pyridine-2-carboxylate?
The IUPAC name of (4-nitrophenyl)methyl pyridine-2-carboxylate (CID 501281) is (4-nitrophenyl)methyl pyridine-2-carboxylate.
What is the SMILES notation for (4-nitrophenyl)methyl pyridine-2-carboxylate?
The canonical SMILES for (4-nitrophenyl)methyl pyridine-2-carboxylate is O=C(OCc1ccc([N+](=O)[O-])cc1)c1ccccn1.
What is the InChIKey of (4-nitrophenyl)methyl pyridine-2-carboxylate?
The InChIKey is VZLAOZFWLRTVNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4/c16-13(12-3-1-2-8-14-12)19-9-10-4-6-11(7-5-10)15(17)18/h1-8H,9H2.
What are the key properties of (4-nitrophenyl)methyl pyridine-2-carboxylate?
(4-nitrophenyl)methyl pyridine-2-carboxylate has a molecular weight of 258.23 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl pyridine-2-carboxylate is sourced from PubChem (CID 501281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).